C28H26ClN3O4 — CID 71764581
3-[(7-chloroquinolin-4-yl)amino]propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate (PubChem CID 71764581) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is 3-[(7-chloroquinolin-4-yl)amino]propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate.
| Compound Name | 3-[(7-chloroquinolin-4-yl)amino]propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 71764581 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 3-[(7-chloroquinolin-4-yl)amino]propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@@H](O)C(=O)OCCCNc1ccnc2cc(Cl)ccc12)c1ccccc1 |
| InChI | InChI=1S/C28H26ClN3O4/c29-21-12-13-22-23(14-16-31-24(22)18-21)30-15-7-17-36-28(35)26(33)25(19-8-3-1-4-9-19)32-27(34)20-10-5-2-6-11-20/h1-6,8-14,16,18,25-26,33H,7,15,17H2,(H,30,31)(H,32,34)/t25-,26+/m0/s1 |
| InChIKey | FLNRLXKRYFJZJQ-IZZNHLLZSA-N |
| XLogP | 4.77 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|