C21H23NO5 — CID 10666775
2-(oxetan-3-yl)ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate (PubChem CID 10666775) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(oxetan-3-yl)ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate.
| Compound Name | 2-(oxetan-3-yl)ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10666775 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(oxetan-3-yl)ethyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@@H](O)C(=O)OCCC1COC1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c23-19(21(25)27-12-11-15-13-26-14-15)18(16-7-3-1-4-8-16)22-20(24)17-9-5-2-6-10-17/h1-10,15,18-19,23H,11-14H2,(H,22,24)/t18-,19+/m0/s1 |
| InChIKey | YOPDSZWTACHWKK-RBUKOAKNSA-N |
| XLogP | 2.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |