C22H25NO5 — CID 11794358
3-(oxetan-3-yl)propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate (PubChem CID 11794358) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-(oxetan-3-yl)propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate.
| Compound Name | 3-(oxetan-3-yl)propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 11794358 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-(oxetan-3-yl)propyl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](c1ccccc1)[C@@H](O)C(=O)OCCCC1COC1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c24-20(22(26)28-13-7-8-16-14-27-15-16)19(17-9-3-1-4-10-17)23-21(25)18-11-5-2-6-12-18/h1-6,9-12,16,19-20,24H,7-8,13-15H2,(H,23,25)/t19-,20+/m0/s1 |
| InChIKey | VNBMGIOEODJGQH-VQTJNVASSA-N |
| XLogP | 2.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|