C28H30ClN5O — CID 58476701
N-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-[2-(N-phenylanilino)ethyl]amino]ethyl]formamide (PubChem CID 58476701) has the molecular formula C28H30ClN5O and a molecular weight of 488.04 g/mol. Its IUPAC name is N-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-[2-(N-phenylanilino)ethyl]amino]ethyl]formamide.
| Compound Name | N-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-[2-(N-phenylanilino)ethyl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 58476701 |
| Molecular Formula | C28H30ClN5O |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[2-[2-[(7-chloroquinolin-4-yl)amino]ethyl-[2-(N-phenylanilino)ethyl]amino]ethyl]formamide |
| SMILES | O=CNCCN(CCNc1ccnc2cc(Cl)ccc12)CCN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30ClN5O/c29-23-11-12-26-27(13-14-31-28(26)21-23)32-16-18-33(17-15-30-22-35)19-20-34(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-14,21-22H,15-20H2,(H,30,35)(H,31,32) |
| InChIKey | QNMLXKRSVYRALM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|