C20H19BrClN3O — CID 42743599
4-bromo-N-[4-[(7-chloroquinolin-4-yl)amino]butyl]benzamide (PubChem CID 42743599) has the molecular formula C20H19BrClN3O and a molecular weight of 432.75 g/mol. Its IUPAC name is 4-bromo-N-[4-[(7-chloroquinolin-4-yl)amino]butyl]benzamide.
| Compound Name | 4-bromo-N-[4-[(7-chloroquinolin-4-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 42743599 |
| Molecular Formula | C20H19BrClN3O |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 4-bromo-N-[4-[(7-chloroquinolin-4-yl)amino]butyl]benzamide |
| SMILES | O=C(NCCCCNc1ccnc2cc(Cl)ccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrClN3O/c21-15-5-3-14(4-6-15)20(26)25-11-2-1-10-23-18-9-12-24-19-13-16(22)7-8-17(18)19/h3-9,12-13H,1-2,10-11H2,(H,23,24)(H,25,26) |
| InChIKey | RGEOMGDZALAFGG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|