C16H13ClF7N3O — CID 44544026
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 44544026) has the molecular formula C16H13ClF7N3O and a molecular weight of 431.74 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 44544026 |
| Molecular Formula | C16H13ClF7N3O |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NCCCNc1ccnc2cc(Cl)ccc12)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13ClF7N3O/c17-9-2-3-10-11(4-7-26-12(10)8-9)25-5-1-6-27-13(28)14(18,19)15(20,21)16(22,23)24/h2-4,7-8H,1,5-6H2,(H,25,26)(H,27,28) |
| InChIKey | ZWESFCWDLRMKOS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|