C18H14ClF10N3O — CID 89119814
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide (PubChem CID 89119814) has the molecular formula C18H14ClF10N3O and a molecular weight of 513.76 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide |
|---|---|
| PubChem CID | 89119814 |
| Molecular Formula | C18H14ClF10N3O |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide |
| SMILES | O=C(NCCCNc1ccnc2cc(Cl)ccc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H14ClF10N3O/c19-9-2-3-10-11(4-7-31-12(10)8-9)30-5-1-6-32-14(33)16(24,25)18(28,29)17(26,27)15(22,23)13(20)21/h2-4,7-8,13H,1,5-6H2,(H,30,31)(H,32,33) |
| InChIKey | VHGUERIAYGPSSC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|