C21H19ClN4O3 — CID 162671196
2-(2-acetamidophenyl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-oxoacetamide (PubChem CID 162671196) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 2-(2-acetamidophenyl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-oxoacetamide.
| Compound Name | 2-(2-acetamidophenyl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 162671196 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-(2-acetamidophenyl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-oxoacetamide |
| SMILES | CC(=O)Nc1ccccc1C(=O)C(=O)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H19ClN4O3/c1-13(27)26-18-5-3-2-4-16(18)20(28)21(29)25-11-10-24-17-8-9-23-19-12-14(22)6-7-15(17)19/h2-9,12H,10-11H2,1H3,(H,23,24)(H,25,29)(H,26,27) |
| InChIKey | VBSYRRQQMCMYJR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|