C28H30ClN7O — CID 155807481
[4-[[2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-methylpyrimidin-4-yl]amino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 155807481) has the molecular formula C28H30ClN7O and a molecular weight of 516.05 g/mol. Its IUPAC name is [4-[[2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-methylpyrimidin-4-yl]amino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-methylpyrimidin-4-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 155807481 |
| Molecular Formula | C28H30ClN7O |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | [4-[[2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-methylpyrimidin-4-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1cc(Nc2ccc(C(=O)N3CCCC3)cc2)nc(NCCCNc2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C28H30ClN7O/c1-19-17-26(34-22-8-5-20(6-9-22)27(37)36-15-2-3-16-36)35-28(33-19)32-13-4-12-30-24-11-14-31-25-18-21(29)7-10-23(24)25/h5-11,14,17-18H,2-4,12-13,15-16H2,1H3,(H,30,31)(H2,32,33,34,35) |
| InChIKey | QEPGOUWRUNYSDC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|