C25H34ClN5 — CID 162259942
7-chloro-N-[5-[2-(hexylamino)-6-methylpyrimidin-4-yl]pentyl]quinolin-4-amine (PubChem CID 162259942) has the molecular formula C25H34ClN5 and a molecular weight of 440.04 g/mol. Its IUPAC name is 7-chloro-N-[5-[2-(hexylamino)-6-methylpyrimidin-4-yl]pentyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[5-[2-(hexylamino)-6-methylpyrimidin-4-yl]pentyl]quinolin-4-amine |
|---|---|
| PubChem CID | 162259942 |
| Molecular Formula | C25H34ClN5 |
| Molecular Weight | 440.04 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 7-chloro-N-[5-[2-(hexylamino)-6-methylpyrimidin-4-yl]pentyl]quinolin-4-amine |
| SMILES | CCCCCCNc1nc(C)cc(CCCCCNc2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C25H34ClN5/c1-3-4-5-8-15-29-25-30-19(2)17-21(31-25)10-7-6-9-14-27-23-13-16-28-24-18-20(26)11-12-22(23)24/h11-13,16-18H,3-10,14-15H2,1-2H3,(H,27,28)(H,29,30,31) |
| InChIKey | CAWIXCHTFUPTQQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.04 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|