C27H29ClN4O — CID 148561208
7-chloro-N-[5-[4-[(4-methoxyphenyl)methyl]-6-methylpyrimidin-2-yl]pentyl]quinolin-4-amine (PubChem CID 148561208) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is 7-chloro-N-[5-[4-[(4-methoxyphenyl)methyl]-6-methylpyrimidin-2-yl]pentyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[5-[4-[(4-methoxyphenyl)methyl]-6-methylpyrimidin-2-yl]pentyl]quinolin-4-amine |
|---|---|
| PubChem CID | 148561208 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 7-chloro-N-[5-[4-[(4-methoxyphenyl)methyl]-6-methylpyrimidin-2-yl]pentyl]quinolin-4-amine |
| SMILES | COc1ccc(Cc2cc(C)nc(CCCCCNc3ccnc4cc(Cl)ccc34)n2)cc1 |
| InChI | InChI=1S/C27H29ClN4O/c1-19-16-22(17-20-7-10-23(33-2)11-8-20)32-27(31-19)6-4-3-5-14-29-25-13-15-30-26-18-21(28)9-12-24(25)26/h7-13,15-16,18H,3-6,14,17H2,1-2H3,(H,29,30) |
| InChIKey | MVAHHDSVHJSHHC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|