C25H25ClN4O2 — CID 158372709
7-chloro-N-[3-[4-[(3,5-dimethoxyphenyl)methyl]pyrimidin-2-yl]propyl]quinolin-4-amine (PubChem CID 158372709) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-[(3,5-dimethoxyphenyl)methyl]pyrimidin-2-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-[(3,5-dimethoxyphenyl)methyl]pyrimidin-2-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 158372709 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 7-chloro-N-[3-[4-[(3,5-dimethoxyphenyl)methyl]pyrimidin-2-yl]propyl]quinolin-4-amine |
| SMILES | COc1cc(Cc2ccnc(CCCNc3ccnc4cc(Cl)ccc34)n2)cc(OC)c1 |
| InChI | InChI=1S/C25H25ClN4O2/c1-31-20-13-17(14-21(16-20)32-2)12-19-7-10-29-25(30-19)4-3-9-27-23-8-11-28-24-15-18(26)5-6-22(23)24/h5-8,10-11,13-16H,3-4,9,12H2,1-2H3,(H,27,28) |
| InChIKey | GUUSGOOLNLEYNH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|