C21H27ClN6O — CID 71735482
5-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-6-methylpyrimidin-2-yl]amino]pentan-1-ol (PubChem CID 71735482) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is 5-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-6-methylpyrimidin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-6-methylpyrimidin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 71735482 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 5-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-6-methylpyrimidin-2-yl]amino]pentan-1-ol |
| SMILES | Cc1cc(NCCNc2ccnc3cc(Cl)ccc23)nc(NCCCCCO)n1 |
| InChI | InChI=1S/C21H27ClN6O/c1-15-13-20(28-21(27-15)26-8-3-2-4-12-29)25-11-10-24-18-7-9-23-19-14-16(22)5-6-17(18)19/h5-7,9,13-14,29H,2-4,8,10-12H2,1H3,(H,23,24)(H2,25,26,27,28) |
| InChIKey | SYAODEUEQUZWEX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|