C26H29ClN6 — CID 157192844
7-chloro-N-[3-[2-(4-ethylpiperazin-1-yl)quinazolin-4-yl]propyl]quinolin-4-amine (PubChem CID 157192844) has the molecular formula C26H29ClN6 and a molecular weight of 461.01 g/mol. Its IUPAC name is 7-chloro-N-[3-[2-(4-ethylpiperazin-1-yl)quinazolin-4-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[2-(4-ethylpiperazin-1-yl)quinazolin-4-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 157192844 |
| Molecular Formula | C26H29ClN6 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 7-chloro-N-[3-[2-(4-ethylpiperazin-1-yl)quinazolin-4-yl]propyl]quinolin-4-amine |
| SMILES | CCN1CCN(c2nc(CCCNc3ccnc4cc(Cl)ccc34)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H29ClN6/c1-2-32-14-16-33(17-15-32)26-30-23-7-4-3-6-20(23)24(31-26)8-5-12-28-22-11-13-29-25-18-19(27)9-10-21(22)25/h3-4,6-7,9-11,13,18H,2,5,8,12,14-17H2,1H3,(H,28,29) |
| InChIKey | JIQQGZWACSZJTQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|