C28H37ClN6 — CID 123368292
7-chloro-N-[3-[4-(3-ethyl-6-methyl-2-pyrrolidin-1-yl-4-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine (PubChem CID 123368292) has the molecular formula C28H37ClN6 and a molecular weight of 493.10 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(3-ethyl-6-methyl-2-pyrrolidin-1-yl-4-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-(3-ethyl-6-methyl-2-pyrrolidin-1-yl-4-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 123368292 |
| Molecular Formula | C28H37ClN6 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 7-chloro-N-[3-[4-(3-ethyl-6-methyl-2-pyrrolidin-1-yl-4-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine |
| SMILES | CCc1c(N2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)cc(C)nc1N1CCCC1 |
| InChI | InChI=1S/C28H37ClN6/c1-3-23-27(19-21(2)32-28(23)35-13-4-5-14-35)34-17-15-33(16-18-34)12-6-10-30-25-9-11-31-26-20-22(29)7-8-24(25)26/h7-9,11,19-20H,3-6,10,12-18H2,1-2H3,(H,30,31) |
| InChIKey | OTXXJFWPPBZHTQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|