C16H19FN2O3 — CID 122059031
4-[(7-fluoro-6-methoxyquinolin-4-yl)amino]-4-methylpentanoic acid (PubChem CID 122059031) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-[(7-fluoro-6-methoxyquinolin-4-yl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(7-fluoro-6-methoxyquinolin-4-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122059031 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-[(7-fluoro-6-methoxyquinolin-4-yl)amino]-4-methylpentanoic acid |
| SMILES | COc1cc2c(NC(C)(C)CCC(=O)O)ccnc2cc1F |
| InChI | InChI=1S/C16H19FN2O3/c1-16(2,6-4-15(20)21)19-12-5-7-18-13-9-11(17)14(22-3)8-10(12)13/h5,7-9H,4,6H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | ASJYWIVDADFQFJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |