C13H16N2O3 — CID 159856965
2-[(6,7-dimethoxyquinolin-4-yl)amino]ethanol (PubChem CID 159856965) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyquinolin-4-yl)amino]ethanol.
| Compound Name | 2-[(6,7-dimethoxyquinolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 159856965 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[(6,7-dimethoxyquinolin-4-yl)amino]ethanol |
| SMILES | COc1cc2nccc(NCCO)c2cc1OC |
| InChI | InChI=1S/C13H16N2O3/c1-17-12-7-9-10(15-5-6-16)3-4-14-11(9)8-13(12)18-2/h3-4,7-8,16H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | VMFAEIKZFYWZSV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |