C17H17ClN2O3 — CID 22646651
3-[(6,7-dimethoxyquinolin-4-yl)amino]phenol;hydrochloride (PubChem CID 22646651) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 3-[(6,7-dimethoxyquinolin-4-yl)amino]phenol;hydrochloride.
| Compound Name | 3-[(6,7-dimethoxyquinolin-4-yl)amino]phenol;hydrochloride |
|---|---|
| PubChem CID | 22646651 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-[(6,7-dimethoxyquinolin-4-yl)amino]phenol;hydrochloride |
| SMILES | COc1cc2nccc(Nc3cccc(O)c3)c2cc1OC.Cl |
| InChI | InChI=1S/C17H16N2O3.ClH/c1-21-16-9-13-14(19-11-4-3-5-12(20)8-11)6-7-18-15(13)10-17(16)22-2;/h3-10,20H,1-2H3,(H,18,19);1H |
| InChIKey | HDCIZTUPEKAWLY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |