C18H15N3O3 — CID 5328853
4-(3-hydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 5328853) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-(3-hydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(3-hydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5328853 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-(3-hydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3cccc(O)c3)c2cc1OC |
| InChI | InChI=1S/C18H15N3O3/c1-23-16-7-14-15(8-17(16)24-2)20-10-11(9-19)18(14)21-12-4-3-5-13(22)6-12/h3-8,10,22H,1-2H3,(H,20,21) |
| InChIKey | IKUBPVIBISSEJV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |