C19H17N3O3 — CID 22466676
4-(2-hydroxy-4-methylanilino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 22466676) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-(2-hydroxy-4-methylanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2-hydroxy-4-methylanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 22466676 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-(2-hydroxy-4-methylanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(C)cc3O)c2cc1OC |
| InChI | InChI=1S/C19H17N3O3/c1-11-4-5-14(16(23)6-11)22-19-12(9-20)10-21-15-8-18(25-3)17(24-2)7-13(15)19/h4-8,10,23H,1-3H3,(H,21,22) |
| InChIKey | VVWPJQJYFBFVJH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|