C18H15N3O4 — CID 22466547
4-(2,4-dihydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 22466547) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-(2,4-dihydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dihydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 22466547 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-(2,4-dihydroxyanilino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(O)cc3O)c2cc1OC |
| InChI | InChI=1S/C18H15N3O4/c1-24-16-6-12-14(7-17(16)25-2)20-9-10(8-19)18(12)21-13-4-3-11(22)5-15(13)23/h3-7,9,22-23H,1-2H3,(H,20,21) |
| InChIKey | TZNVNORLQOCTMY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|