C17H10ClFN4O3 — CID 22466695
4-(4-chloro-2-fluoroanilino)-7-methoxy-6-nitroquinoline-3-carbonitrile (PubChem CID 22466695) has the molecular formula C17H10ClFN4O3 and a molecular weight of 372.74 g/mol. Its IUPAC name is 4-(4-chloro-2-fluoroanilino)-7-methoxy-6-nitroquinoline-3-carbonitrile.
| Compound Name | 4-(4-chloro-2-fluoroanilino)-7-methoxy-6-nitroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 22466695 |
| Molecular Formula | C17H10ClFN4O3 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-(4-chloro-2-fluoroanilino)-7-methoxy-6-nitroquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(Cl)cc3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10ClFN4O3/c1-26-16-6-14-11(5-15(16)23(24)25)17(9(7-20)8-21-14)22-13-3-2-10(18)4-12(13)19/h2-6,8H,1H3,(H,21,22) |
| InChIKey | RWPARJNAESKYRJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|