C18H15Cl2N3O2 — CID 71779766
6-chloro-4-(2,4-dimethoxyanilino)quinoline-3-carbonitrile;hydrochloride (PubChem CID 71779766) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 6-chloro-4-(2,4-dimethoxyanilino)quinoline-3-carbonitrile;hydrochloride.
| Compound Name | 6-chloro-4-(2,4-dimethoxyanilino)quinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 71779766 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 6-chloro-4-(2,4-dimethoxyanilino)quinoline-3-carbonitrile;hydrochloride |
| SMILES | COc1ccc(Nc2c(C#N)cnc3ccc(Cl)cc23)c(OC)c1.Cl |
| InChI | InChI=1S/C18H14ClN3O2.ClH/c1-23-13-4-6-16(17(8-13)24-2)22-18-11(9-20)10-21-15-5-3-12(19)7-14(15)18;/h3-8,10H,1-2H3,(H,21,22);1H |
| InChIKey | IJVUDDBICKMXSD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |