C19H16N4O3 — CID 22466655
2-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]benzamide (PubChem CID 22466655) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]benzamide.
| Compound Name | 2-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 22466655 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]benzamide |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccccc3C(N)=O)c2cc1OC |
| InChI | InChI=1S/C19H16N4O3/c1-25-16-7-13-15(8-17(16)26-2)22-10-11(9-20)18(13)23-14-6-4-3-5-12(14)19(21)24/h3-8,10H,1-2H3,(H2,21,24)(H,22,23) |
| InChIKey | SJWUQOFLNWMOIP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |