C19H13N3O — CID 166629629
4-(3-ethynylanilino)-7-methoxyquinoline-3-carbonitrile (PubChem CID 166629629) has the molecular formula C19H13N3O and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-(3-ethynylanilino)-7-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-(3-ethynylanilino)-7-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166629629 |
| Molecular Formula | C19H13N3O |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-(3-ethynylanilino)-7-methoxyquinoline-3-carbonitrile |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C19H13N3O/c1-3-13-5-4-6-15(9-13)22-19-14(11-20)12-21-18-10-16(23-2)7-8-17(18)19/h1,4-10,12H,2H3,(H,21,22) |
| InChIKey | BQICFWVFOWXHJT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|