C19H18ClN3O — CID 146055704
6-ethyl-4-(3-methoxyanilino)quinoline-3-carbonitrile;hydrochloride (PubChem CID 146055704) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 6-ethyl-4-(3-methoxyanilino)quinoline-3-carbonitrile;hydrochloride.
| Compound Name | 6-ethyl-4-(3-methoxyanilino)quinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 146055704 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-ethyl-4-(3-methoxyanilino)quinoline-3-carbonitrile;hydrochloride |
| SMILES | CCc1ccc2ncc(C#N)c(Nc3cccc(OC)c3)c2c1.Cl |
| InChI | InChI=1S/C19H17N3O.ClH/c1-3-13-7-8-18-17(9-13)19(14(11-20)12-21-18)22-15-5-4-6-16(10-15)23-2;/h4-10,12H,3H2,1-2H3,(H,21,22);1H |
| InChIKey | QASQQJPEPFJZKF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |