C24H23N3O4 — CID 22466732
4-(3-ethynylanilino)-5,6-bis(2-methoxyethoxy)quinoline-3-carbonitrile (PubChem CID 22466732) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-(3-ethynylanilino)-5,6-bis(2-methoxyethoxy)quinoline-3-carbonitrile.
| Compound Name | 4-(3-ethynylanilino)-5,6-bis(2-methoxyethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 22466732 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(3-ethynylanilino)-5,6-bis(2-methoxyethoxy)quinoline-3-carbonitrile |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3ccc(OCCOC)c(OCCOC)c23)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-4-17-6-5-7-19(14-17)27-23-18(15-25)16-26-20-8-9-21(30-12-10-28-2)24(22(20)23)31-13-11-29-3/h1,5-9,14,16H,10-13H2,2-3H3,(H,26,27) |
| InChIKey | KVYCWMHOGHOGBV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|