C29H28FN3O6 — CID 69053180
4-[4-(3-fluorophenoxy)-3-methoxyanilino]-6,7-bis(2-methoxyethoxy)quinoline-3-carbonitrile (PubChem CID 69053180) has the molecular formula C29H28FN3O6 and a molecular weight of 533.56 g/mol. Its IUPAC name is 4-[4-(3-fluorophenoxy)-3-methoxyanilino]-6,7-bis(2-methoxyethoxy)quinoline-3-carbonitrile.
| Compound Name | 4-[4-(3-fluorophenoxy)-3-methoxyanilino]-6,7-bis(2-methoxyethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69053180 |
| Molecular Formula | C29H28FN3O6 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 4-[4-(3-fluorophenoxy)-3-methoxyanilino]-6,7-bis(2-methoxyethoxy)quinoline-3-carbonitrile |
| SMILES | COCCOc1cc2ncc(C#N)c(Nc3ccc(Oc4cccc(F)c4)c(OC)c3)c2cc1OCCOC |
| InChI | InChI=1S/C29H28FN3O6/c1-34-9-11-37-27-15-23-24(16-28(27)38-12-10-35-2)32-18-19(17-31)29(23)33-21-7-8-25(26(14-21)36-3)39-22-6-4-5-20(30)13-22/h4-8,13-16,18H,9-12H2,1-3H3,(H,32,33) |
| InChIKey | CYMNQVBKGPBXMI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|