C24H24ClFN4O4 — CID 85471342
7-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-methoxyquinolin-6-yl]oxy-N-hydroxyheptanamide (PubChem CID 85471342) has the molecular formula C24H24ClFN4O4 and a molecular weight of 486.93 g/mol. Its IUPAC name is 7-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-methoxyquinolin-6-yl]oxy-N-hydroxyheptanamide.
| Compound Name | 7-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-methoxyquinolin-6-yl]oxy-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 85471342 |
| Molecular Formula | C24H24ClFN4O4 |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 7-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-methoxyquinolin-6-yl]oxy-N-hydroxyheptanamide |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1OCCCCCCC(=O)NO |
| InChI | InChI=1S/C24H24ClFN4O4/c1-33-21-12-20-17(11-22(21)34-9-5-3-2-4-6-23(31)30-32)24(15(13-27)14-28-20)29-16-7-8-19(26)18(25)10-16/h7-8,10-12,14,32H,2-6,9H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | PZLGDCVJDILKLD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|