C32H31ClN4O5 — CID 142026555
2-[3-[4-[[7-(3-chloropropoxy)-3-cyano-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-cyclobutylacetamide (PubChem CID 142026555) has the molecular formula C32H31ClN4O5 and a molecular weight of 587.08 g/mol. Its IUPAC name is 2-[3-[4-[[7-(3-chloropropoxy)-3-cyano-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-cyclobutylacetamide.
| Compound Name | 2-[3-[4-[[7-(3-chloropropoxy)-3-cyano-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-cyclobutylacetamide |
|---|---|
| PubChem CID | 142026555 |
| Molecular Formula | C32H31ClN4O5 |
| Molecular Weight | 587.08 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 2-[3-[4-[[7-(3-chloropropoxy)-3-cyano-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-cyclobutylacetamide |
| SMILES | COc1cc2c(Nc3ccc(Oc4cccc(OCC(=O)NC5CCC5)c4)cc3)c(C#N)cnc2cc1OCCCCl |
| InChI | InChI=1S/C32H31ClN4O5/c1-39-29-16-27-28(17-30(29)40-14-4-13-33)35-19-21(18-34)32(27)37-23-9-11-24(12-10-23)42-26-8-3-7-25(15-26)41-20-31(38)36-22-5-2-6-22/h3,7-12,15-17,19,22H,2,4-6,13-14,20H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | MEGRLMWOFGXCKN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.08 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|