C26H23N5O4 — CID 21035003
2-[2-[4-[(7-amino-3-cyano-6-methoxyquinolin-4-yl)amino]phenoxy]phenoxy]-N-methylacetamide (PubChem CID 21035003) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[2-[4-[(7-amino-3-cyano-6-methoxyquinolin-4-yl)amino]phenoxy]phenoxy]-N-methylacetamide.
| Compound Name | 2-[2-[4-[(7-amino-3-cyano-6-methoxyquinolin-4-yl)amino]phenoxy]phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 21035003 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[2-[4-[(7-amino-3-cyano-6-methoxyquinolin-4-yl)amino]phenoxy]phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1ccccc1Oc1ccc(Nc2c(C#N)cnc3cc(N)c(OC)cc23)cc1 |
| InChI | InChI=1S/C26H23N5O4/c1-29-25(32)15-34-22-5-3-4-6-23(22)35-18-9-7-17(8-10-18)31-26-16(13-27)14-30-21-12-20(28)24(33-2)11-19(21)26/h3-12,14H,15,28H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | RICALGXDYXOLCR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|