C28H21N5O2 — CID 89496193
6-amino-4-(4-phenylmethoxyanilino)-7-pyridin-4-yloxyquinoline-3-carbonitrile (PubChem CID 89496193) has the molecular formula C28H21N5O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 6-amino-4-(4-phenylmethoxyanilino)-7-pyridin-4-yloxyquinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(4-phenylmethoxyanilino)-7-pyridin-4-yloxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496193 |
| Molecular Formula | C28H21N5O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 6-amino-4-(4-phenylmethoxyanilino)-7-pyridin-4-yloxyquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(Oc3ccncc3)c(N)cc2c1Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N5O2/c29-16-20-17-32-26-15-27(35-23-10-12-31-13-11-23)25(30)14-24(26)28(20)33-21-6-8-22(9-7-21)34-18-19-4-2-1-3-5-19/h1-15,17H,18,30H2,(H,32,33) |
| InChIKey | RUPRRGAWVDGBFA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|