C32H26Cl2N4O5 — CID 11786868
4-[3-chloro-4-[(4-phenylmethoxyphenyl)methoxy]anilino]-7-ethoxy-6-nitroquinoline-3-carbonitrile;hydrochloride (PubChem CID 11786868) has the molecular formula C32H26Cl2N4O5 and a molecular weight of 617.49 g/mol. Its IUPAC name is 4-[3-chloro-4-[(4-phenylmethoxyphenyl)methoxy]anilino]-7-ethoxy-6-nitroquinoline-3-carbonitrile;hydrochloride.
| Compound Name | 4-[3-chloro-4-[(4-phenylmethoxyphenyl)methoxy]anilino]-7-ethoxy-6-nitroquinoline-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 11786868 |
| Molecular Formula | C32H26Cl2N4O5 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 4-[3-chloro-4-[(4-phenylmethoxyphenyl)methoxy]anilino]-7-ethoxy-6-nitroquinoline-3-carbonitrile;hydrochloride |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccc(OCc5ccccc5)cc4)c(Cl)c3)c2cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C32H25ClN4O5.ClH/c1-2-40-31-16-28-26(15-29(31)37(38)39)32(23(17-34)18-35-28)36-24-10-13-30(27(33)14-24)42-20-22-8-11-25(12-9-22)41-19-21-6-4-3-5-7-21;/h3-16,18H,2,19-20H2,1H3,(H,35,36);1H |
| InChIKey | MLRUSCQQPZRHHY-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|