C29H27ClN6O3 — CID 69260779
2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(methylamino)but-2-enamide (PubChem CID 69260779) has the molecular formula C29H27ClN6O3 and a molecular weight of 543.03 g/mol. Its IUPAC name is 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(methylamino)but-2-enamide.
| Compound Name | 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(methylamino)but-2-enamide |
|---|---|
| PubChem CID | 69260779 |
| Molecular Formula | C29H27ClN6O3 |
| Molecular Weight | 543.03 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(methylamino)but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1C(=CCNC)C(N)=O |
| InChI | InChI=1S/C29H27ClN6O3/c1-3-38-27-14-25-23(13-22(27)21(29(32)37)9-11-33-2)28(18(15-31)16-35-25)36-19-7-8-26(24(30)12-19)39-17-20-6-4-5-10-34-20/h4-10,12-14,16,33H,3,11,17H2,1-2H3,(H2,32,37)(H,35,36) |
| InChIKey | QMAPQHPNBWYZOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|