C29H26ClN5O5S — CID 175393060
(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-methylsulfonylbut-2-enamide (PubChem CID 175393060) has the molecular formula C29H26ClN5O5S and a molecular weight of 592.08 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-methylsulfonylbut-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-methylsulfonylbut-2-enamide |
|---|---|
| PubChem CID | 175393060 |
| Molecular Formula | C29H26ClN5O5S |
| Molecular Weight | 592.08 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-methylsulfonylbut-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1NC(=O)/C=C/CS(C)(=O)=O |
| InChI | InChI=1S/C29H26ClN5O5S/c1-3-39-27-15-24-22(14-25(27)35-28(36)8-6-12-41(2,37)38)29(19(16-31)17-33-24)34-20-9-10-26(23(30)13-20)40-18-21-7-4-5-11-32-21/h4-11,13-15,17H,3,12,18H2,1-2H3,(H,33,34)(H,35,36)/b8-6+ |
| InChIKey | DYELOGKOKKUHGX-SOFGYWHQSA-N |
| XLogP | 5.42 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|