C28H22ClN5O3 — CID 134556449
N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]buta-2,3-dienamide (PubChem CID 134556449) has the molecular formula C28H22ClN5O3 and a molecular weight of 511.97 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]buta-2,3-dienamide.
| Compound Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 134556449 |
| Molecular Formula | C28H22ClN5O3 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc2cc1OCC |
| InChI | InChI=1S/C28H22ClN5O3/c1-3-7-27(35)34-24-13-21-23(14-26(24)36-4-2)32-16-18(15-30)28(21)33-19-9-10-25(22(29)12-19)37-17-20-8-5-6-11-31-20/h5-14,16H,1,4,17H2,2H3,(H,32,33)(H,34,35) |
| InChIKey | GRBXBRNTGMQSHI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|