C32H32ClIN6O2 — CID 163621444
4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-6-[3-[[(2S)-1-methylpyrrolidin-2-yl]-λ3-iodanylidene]prop-1-en-2-ylamino]quinoline-3-carbonitrile (PubChem CID 163621444) has the molecular formula C32H32ClIN6O2 and a molecular weight of 695.01 g/mol. Its IUPAC name is 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-6-[3-[[(2S)-1-methylpyrrolidin-2-yl]-λ3-iodanylidene]prop-1-en-2-ylamino]quinoline-3-carbonitrile.
| Compound Name | 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-6-[3-[[(2S)-1-methylpyrrolidin-2-yl]-λ3-iodanylidene]prop-1-en-2-ylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 163621444 |
| Molecular Formula | C32H32ClIN6O2 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.13 |
| IUPAC Name | 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-6-[3-[[(2S)-1-methylpyrrolidin-2-yl]-λ3-iodanylidene]prop-1-en-2-ylamino]quinoline-3-carbonitrile |
| SMILES | C=C(/C=I/[C@H]1CCCN1C)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc2cc1OCC |
| InChI | InChI=1S/C32H32ClIN6O2/c1-4-41-30-16-27-25(15-28(30)38-21(2)17-34-31-9-7-13-40(31)3)32(22(18-35)19-37-27)39-23-10-11-29(26(33)14-23)42-20-24-8-5-6-12-36-24/h5-6,8,10-12,14-17,19,31,38H,2,4,7,9,13,20H2,1,3H3,(H,37,39)/t31-/m1/s1 |
| InChIKey | HOLINQKCNQXNDL-WJOKGBTCSA-N |
| XLogP | 7.63 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|