C30H28ClN5O3 — CID 161335811
4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[(E)-4-(dimethylamino)-2-oxobut-3-enyl]-7-ethoxyquinoline-3-carbonitrile (PubChem CID 161335811) has the molecular formula C30H28ClN5O3 and a molecular weight of 542.04 g/mol. Its IUPAC name is 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[(E)-4-(dimethylamino)-2-oxobut-3-enyl]-7-ethoxyquinoline-3-carbonitrile.
| Compound Name | 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[(E)-4-(dimethylamino)-2-oxobut-3-enyl]-7-ethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 161335811 |
| Molecular Formula | C30H28ClN5O3 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-[(E)-4-(dimethylamino)-2-oxobut-3-enyl]-7-ethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1CC(=O)/C=C/N(C)C |
| InChI | InChI=1S/C30H28ClN5O3/c1-4-38-29-16-27-25(14-20(29)13-24(37)10-12-36(2)3)30(21(17-32)18-34-27)35-22-8-9-28(26(31)15-22)39-19-23-7-5-6-11-33-23/h5-12,14-16,18H,4,13,19H2,1-3H3,(H,34,35)/b12-10+ |
| InChIKey | KSWHXPKJDRSWNO-ZRDIBKRKSA-N |
| XLogP | 6.06 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|