C27H21ClFN5O3 — CID 85471289
N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-fluoroprop-2-enamide (PubChem CID 85471289) has the molecular formula C27H21ClFN5O3 and a molecular weight of 517.95 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-fluoroprop-2-enamide.
| Compound Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 85471289 |
| Molecular Formula | C27H21ClFN5O3 |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc2cc1OCC |
| InChI | InChI=1S/C27H21ClFN5O3/c1-3-36-25-12-22-20(11-23(25)34-27(35)16(2)29)26(17(13-30)14-32-22)33-18-7-8-24(21(28)10-18)37-15-19-6-4-5-9-31-19/h4-12,14H,2-3,15H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | FOJWQDDMTZZILM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|