C33H32ClN5O3 — CID 72963993
N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-pyrrolidin-1-ylbut-2-enamide (PubChem CID 72963993) has the molecular formula C33H32ClN5O3 and a molecular weight of 582.10 g/mol. Its IUPAC name is N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-pyrrolidin-1-ylbut-2-enamide.
| Compound Name | N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-pyrrolidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 72963993 |
| Molecular Formula | C33H32ClN5O3 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-[4-(3-chloro-4-phenylmethoxyanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-pyrrolidin-1-ylbut-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccc4)c(Cl)c3)c2cc1NC(=O)C=CCN1CCCC1 |
| InChI | InChI=1S/C33H32ClN5O3/c1-2-41-31-19-28-26(18-29(31)38-32(40)11-8-16-39-14-6-7-15-39)33(24(20-35)21-36-28)37-25-12-13-30(27(34)17-25)42-22-23-9-4-3-5-10-23/h3-5,8-13,17-19,21H,2,6-7,14-16,22H2,1H3,(H,36,37)(H,38,40) |
| InChIKey | WHAIZABWYXHNPG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|