C27H20Cl2N4O5 — CID 89496563
4-[3-chloro-4-[(2-chlorophenyl)methoxy]anilino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile (PubChem CID 89496563) has the molecular formula C27H20Cl2N4O5 and a molecular weight of 551.39 g/mol. Its IUPAC name is 4-[3-chloro-4-[(2-chlorophenyl)methoxy]anilino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile.
| Compound Name | 4-[3-chloro-4-[(2-chlorophenyl)methoxy]anilino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496563 |
| Molecular Formula | C27H20Cl2N4O5 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 4-[3-chloro-4-[(2-chlorophenyl)methoxy]anilino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c([N+](=O)[O-])cc2c1Nc1ccc(OCc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H20Cl2N4O5/c28-21-4-2-1-3-16(21)14-37-25-6-5-18(9-22(25)29)32-27-17(12-30)13-31-23-11-26(38-19-7-8-36-15-19)24(33(34)35)10-20(23)27/h1-6,9-11,13,19H,7-8,14-15H2,(H,31,32) |
| InChIKey | WWOPRCHKWVQHOL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|