C22H20N4O4 — CID 89496230
6-nitro-7-(oxolan-3-yloxy)-4-[[(1S)-1-phenylethyl]amino]quinoline-3-carbonitrile (PubChem CID 89496230) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 6-nitro-7-(oxolan-3-yloxy)-4-[[(1S)-1-phenylethyl]amino]quinoline-3-carbonitrile.
| Compound Name | 6-nitro-7-(oxolan-3-yloxy)-4-[[(1S)-1-phenylethyl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496230 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-nitro-7-(oxolan-3-yloxy)-4-[[(1S)-1-phenylethyl]amino]quinoline-3-carbonitrile |
| SMILES | C[C@H](Nc1c(C#N)cnc2cc(OC3CCOC3)c([N+](=O)[O-])cc12)c1ccccc1 |
| InChI | InChI=1S/C22H20N4O4/c1-14(15-5-3-2-4-6-15)25-22-16(11-23)12-24-19-10-21(30-17-7-8-29-13-17)20(26(27)28)9-18(19)22/h2-6,9-10,12,14,17H,7-8,13H2,1H3,(H,24,25)/t14-,17?/m0/s1 |
| InChIKey | DIZJFYXQHQMMRG-MBIQTGHCSA-N |
| XLogP | 4.36 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|