C18H16N6O2 — CID 89496271
6-amino-7-(oxolan-3-yloxy)-4-(pyrazin-2-ylamino)quinoline-3-carbonitrile (PubChem CID 89496271) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 6-amino-7-(oxolan-3-yloxy)-4-(pyrazin-2-ylamino)quinoline-3-carbonitrile.
| Compound Name | 6-amino-7-(oxolan-3-yloxy)-4-(pyrazin-2-ylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496271 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6-amino-7-(oxolan-3-yloxy)-4-(pyrazin-2-ylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(N)cc2c1Nc1cnccn1 |
| InChI | InChI=1S/C18H16N6O2/c19-7-11-8-23-15-6-16(26-12-1-4-25-10-12)14(20)5-13(15)18(11)24-17-9-21-2-3-22-17/h2-3,5-6,8-9,12H,1,4,10,20H2,(H,22,23,24) |
| InChIKey | QHXUYQQBWQJANY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|