C12H14N4O2 — CID 164962336
7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine (PubChem CID 164962336) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine.
| Compound Name | 7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 164962336 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine |
| SMILES | Nc1cc2c(N)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C12H14N4O2/c13-9-3-8-10(15-6-16-12(8)14)4-11(9)18-7-1-2-17-5-7/h3-4,6-7H,1-2,5,13H2,(H2,14,15,16)/t7-/m0/s1 |
| InChIKey | BZWRFVGPTWNOFV-ZETCQYMHSA-N |
| XLogP | 0.96 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|