C18H16ClFN4O2 — CID 67006510
2-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)quinazoline-4,6-diamine (PubChem CID 67006510) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)quinazoline-4,6-diamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 67006510 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-7-(oxolan-3-yloxy)quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(N)nc(-c3ccc(F)c(Cl)c3)nc2cc1OC1CCOC1 |
| InChI | InChI=1S/C18H16ClFN4O2/c19-12-5-9(1-2-13(12)20)18-23-15-7-16(26-10-3-4-25-8-10)14(21)6-11(15)17(22)24-18/h1-2,5-7,10H,3-4,8,21H2,(H2,22,23,24) |
| InChIKey | MYNPSNLTFJHFEG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|