C19H16F4N4O2S — CID 175480191
7-(oxolan-3-yloxy)-2-(2,3,4,5-tetrafluoro-6-methylsulfanylphenyl)quinazoline-4,6-diamine (PubChem CID 175480191) has the molecular formula C19H16F4N4O2S and a molecular weight of 440.42 g/mol. Its IUPAC name is 7-(oxolan-3-yloxy)-2-(2,3,4,5-tetrafluoro-6-methylsulfanylphenyl)quinazoline-4,6-diamine.
| Compound Name | 7-(oxolan-3-yloxy)-2-(2,3,4,5-tetrafluoro-6-methylsulfanylphenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 175480191 |
| Molecular Formula | C19H16F4N4O2S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 7-(oxolan-3-yloxy)-2-(2,3,4,5-tetrafluoro-6-methylsulfanylphenyl)quinazoline-4,6-diamine |
| SMILES | CSc1c(F)c(F)c(F)c(F)c1-c1nc(N)c2cc(N)c(OC3CCOC3)cc2n1 |
| InChI | InChI=1S/C19H16F4N4O2S/c1-30-17-12(13(20)14(21)15(22)16(17)23)19-26-10-5-11(29-7-2-3-28-6-7)9(24)4-8(10)18(25)27-19/h4-5,7H,2-3,6,24H2,1H3,(H2,25,26,27) |
| InChIKey | QXYKPHHZTZYLIE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|