C27H22ClFN4O3 — CID 89496232
6-amino-4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]-7-(oxolan-3-yloxy)quinoline-3-carbonitrile (PubChem CID 89496232) has the molecular formula C27H22ClFN4O3 and a molecular weight of 504.95 g/mol. Its IUPAC name is 6-amino-4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]-7-(oxolan-3-yloxy)quinoline-3-carbonitrile.
| Compound Name | 6-amino-4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496232 |
| Molecular Formula | C27H22ClFN4O3 |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 6-amino-4-[3-chloro-4-[(2-fluorophenyl)methoxy]anilino]-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(N)cc2c1Nc1ccc(OCc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C27H22ClFN4O3/c28-21-9-18(5-6-25(21)35-14-16-3-1-2-4-22(16)29)33-27-17(12-30)13-32-24-11-26(23(31)10-20(24)27)36-19-7-8-34-15-19/h1-6,9-11,13,19H,7-8,14-15,31H2,(H,32,33) |
| InChIKey | VVVAXQZNDNBKJY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|