C26H21N7O6 — CID 89496471
5-[[3-cyano-6-nitro-7-(oxolan-3-yloxy)quinolin-4-yl]amino]-N-(4-methoxyphenyl)pyrimidine-2-carboxamide (PubChem CID 89496471) has the molecular formula C26H21N7O6 and a molecular weight of 527.50 g/mol. Its IUPAC name is 5-[[3-cyano-6-nitro-7-(oxolan-3-yloxy)quinolin-4-yl]amino]-N-(4-methoxyphenyl)pyrimidine-2-carboxamide.
| Compound Name | 5-[[3-cyano-6-nitro-7-(oxolan-3-yloxy)quinolin-4-yl]amino]-N-(4-methoxyphenyl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 89496471 |
| Molecular Formula | C26H21N7O6 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 5-[[3-cyano-6-nitro-7-(oxolan-3-yloxy)quinolin-4-yl]amino]-N-(4-methoxyphenyl)pyrimidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ncc(Nc3c(C#N)cnc4cc(OC5CCOC5)c([N+](=O)[O-])cc34)cn2)cc1 |
| InChI | InChI=1S/C26H21N7O6/c1-37-18-4-2-16(3-5-18)32-26(34)25-29-12-17(13-30-25)31-24-15(10-27)11-28-21-9-23(39-19-6-7-38-14-19)22(33(35)36)8-20(21)24/h2-5,8-9,11-13,19H,6-7,14H2,1H3,(H,28,31)(H,32,34) |
| InChIKey | FIQXJNIPZWRXIX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 174.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|