C24H21N5O3 — CID 89496418
4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxy-6-nitroquinoline-3-carbonitrile (PubChem CID 89496418) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxy-6-nitroquinoline-3-carbonitrile.
| Compound Name | 4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxy-6-nitroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496418 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxy-6-nitroquinoline-3-carbonitrile |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(OC4CCN(C)CC4)c([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C24H21N5O3/c1-3-16-5-4-6-18(11-16)27-24-17(14-25)15-26-21-13-23(22(29(30)31)12-20(21)24)32-19-7-9-28(2)10-8-19/h1,4-6,11-13,15,19H,7-10H2,2H3,(H,26,27) |
| InChIKey | JQTSGSQPYKIBOR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|