C31H31N5O3 — CID 89496454
(E)-N-[3-cyano-4-(3-ethynylanilino)-7-(oxolan-3-yloxy)quinolin-6-yl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 89496454) has the molecular formula C31H31N5O3 and a molecular weight of 521.62 g/mol. Its IUPAC name is (E)-N-[3-cyano-4-(3-ethynylanilino)-7-(oxolan-3-yloxy)quinolin-6-yl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[3-cyano-4-(3-ethynylanilino)-7-(oxolan-3-yloxy)quinolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 89496454 |
| Molecular Formula | C31H31N5O3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (E)-N-[3-cyano-4-(3-ethynylanilino)-7-(oxolan-3-yloxy)quinolin-6-yl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(OC4CCOC4)c(NC(=O)/C=C/CN4CCCCC4)cc23)c1 |
| InChI | InChI=1S/C31H31N5O3/c1-2-22-8-6-9-24(16-22)34-31-23(19-32)20-33-27-18-29(39-25-11-15-38-21-25)28(17-26(27)31)35-30(37)10-7-14-36-12-4-3-5-13-36/h1,6-10,16-18,20,25H,3-5,11-15,21H2,(H,33,34)(H,35,37)/b10-7+ |
| InChIKey | LPIIBXMORJZRKC-JXMROGBWSA-N |
| XLogP | 4.98 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|